C19H17BrN2O5 — CID 3917462
methyl 2-[4-bromo-2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]acetate (PubChem CID 3917462) has the molecular formula C19H17BrN2O5 and a molecular weight of 433.26 g/mol. Its IUPAC name is methyl 2-[4-bromo-2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-bromo-2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3917462 |
| Molecular Formula | C19H17BrN2O5 |
| Molecular Weight | 433.26 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | methyl 2-[4-bromo-2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(Br)cc1C=NN1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C19H17BrN2O5/c1-26-15(23)9-27-14-5-4-13(20)7-12(14)8-21-22-18(24)16-10-2-3-11(6-10)17(16)19(22)25/h2-5,7-8,10-11,16-17H,6,9H2,1H3 |
| InChIKey | MAYGKSSGCSSPKY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|