C22H22BrN3O5 — CID 126408206
(1R,2R,6S,7R)-4-[[5-bromo-2-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 126408206) has the molecular formula C22H22BrN3O5 and a molecular weight of 488.34 g/mol. Its IUPAC name is (1R,2R,6S,7R)-4-[[5-bromo-2-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7R)-4-[[5-bromo-2-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126408206 |
| Molecular Formula | C22H22BrN3O5 |
| Molecular Weight | 488.34 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | (1R,2R,6S,7R)-4-[[5-bromo-2-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C(COc1ccc(Br)cc1C=NN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2C1)N1CCOCC1 |
| InChI | InChI=1S/C22H22BrN3O5/c23-16-3-4-17(31-12-18(27)25-5-7-30-8-6-25)15(10-16)11-24-26-21(28)19-13-1-2-14(9-13)20(19)22(26)29/h1-4,10-11,13-14,19-20H,5-9,12H2/t13-,14-,19-,20+/m0/s1 |
| InChIKey | AYQXTPLRDJVNTI-WZBLMQSHSA-N |
| XLogP | 1.83 |
| TPSA | 88.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|