C21H19BrN2O3 — CID 124832815
(1S,2R,6S,7S,8R,10R)-4-[(Z)-(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 124832815) has the molecular formula C21H19BrN2O3 and a molecular weight of 427.30 g/mol. Its IUPAC name is (1S,2R,6S,7S,8R,10R)-4-[(Z)-(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1S,2R,6S,7S,8R,10R)-4-[(Z)-(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 124832815 |
| Molecular Formula | C21H19BrN2O3 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | (1S,2R,6S,7S,8R,10R)-4-[(Z)-(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | C=CCOc1ccc(Br)cc1/C=N\N1C(=O)[C@@H]2[C@H]3C=C[C@@H]([C@@H]4C[C@@H]34)[C@@H]2C1=O |
| InChI | InChI=1S/C21H19BrN2O3/c1-2-7-27-17-6-3-12(22)8-11(17)10-23-24-20(25)18-13-4-5-14(16-9-15(13)16)19(18)21(24)26/h2-6,8,10,13-16,18-19H,1,7,9H2/b23-10-/t13-,14-,15-,16-,18-,19+/m0/s1 |
| InChIKey | AQKDHSBWQZARKV-NDZXVEAKSA-N |
| XLogP | 3.40 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|