C25H19BrI2N2O3 — CID 100814061
(1R,2R,6S,7R,8R,10S)-4-[(Z)-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 100814061) has the molecular formula C25H19BrI2N2O3 and a molecular weight of 729.15 g/mol. Its IUPAC name is (1R,2R,6S,7R,8R,10S)-4-[(Z)-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7R,8R,10S)-4-[(Z)-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 100814061 |
| Molecular Formula | C25H19BrI2N2O3 |
| Molecular Weight | 729.15 g/mol |
| Exact Mass | 727.87 |
| IUPAC Name | (1R,2R,6S,7R,8R,10S)-4-[(Z)-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H]3C=C[C@H]([C@@H]4C[C@H]34)[C@@H]2C(=O)N1/N=C\c1cc(I)c(OCc2ccc(Br)cc2)c(I)c1 |
| InChI | InChI=1S/C25H19BrI2N2O3/c26-14-3-1-12(2-4-14)11-33-23-19(27)7-13(8-20(23)28)10-29-30-24(31)21-15-5-6-16(18-9-17(15)18)22(21)25(30)32/h1-8,10,15-18,21-22H,9,11H2/b29-10-/t15-,16-,17-,18+,21-,22+/m1/s1 |
| InChIKey | CYGLQPGSLUTDKC-PYMNNZLGSA-N |
| XLogP | 5.62 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.15 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|