C27H24IN3O6 — CID 126054842
(1S,2S,6R,7S,8S,10R)-4-[(Z)-[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 126054842) has the molecular formula C27H24IN3O6 and a molecular weight of 613.41 g/mol. Its IUPAC name is (1S,2S,6R,7S,8S,10R)-4-[(Z)-[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1S,2S,6R,7S,8S,10R)-4-[(Z)-[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 126054842 |
| Molecular Formula | C27H24IN3O6 |
| Molecular Weight | 613.41 g/mol |
| Exact Mass | 613.07 |
| IUPAC Name | (1S,2S,6R,7S,8S,10R)-4-[(Z)-[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | CCOc1cc(/C=N\N2C(=O)[C@@H]3[C@H]4C=C[C@@H]([C@@H]5C[C@H]45)[C@@H]3C2=O)cc(I)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H24IN3O6/c1-2-36-22-10-15(9-21(28)25(22)37-13-14-3-5-16(6-4-14)31(34)35)12-29-30-26(32)23-17-7-8-18(20-11-19(17)20)24(23)27(30)33/h3-10,12,17-20,23-24H,2,11,13H2,1H3/b29-12-/t17-,18-,19-,20+,23-,24+/m0/s1 |
| InChIKey | SWYGYCHKUUKCOV-ALVQDCHISA-N |
| XLogP | 4.56 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|