C26H22ClIN2O4 — CID 126088926
(1S,2R,6R,7S,8R,10S)-4-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 126088926) has the molecular formula C26H22ClIN2O4 and a molecular weight of 588.83 g/mol. Its IUPAC name is (1S,2R,6R,7S,8R,10S)-4-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1S,2R,6R,7S,8R,10S)-4-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 126088926 |
| Molecular Formula | C26H22ClIN2O4 |
| Molecular Weight | 588.83 g/mol |
| Exact Mass | 588.03 |
| IUPAC Name | (1S,2R,6R,7S,8R,10S)-4-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | COc1cc(/C=N\N2C(=O)[C@@H]3[C@H]4C=C[C@@H]([C@@H]5C[C@H]45)[C@H]3C2=O)cc(I)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C26H22ClIN2O4/c1-33-21-9-13(8-20(28)24(21)34-12-14-4-2-3-5-19(14)27)11-29-30-25(31)22-15-6-7-16(18-10-17(15)18)23(22)26(30)32/h2-9,11,15-18,22-23H,10,12H2,1H3/b29-11-/t15-,16-,17-,18+,22+,23+/m0/s1 |
| InChIKey | JKJKFFAYHPHBEE-XDYLKLKYSA-N |
| XLogP | 4.92 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.83 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|