C34H26ClIN2O4 — CID 126167506
(15S,19S)-17-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 126167506) has the molecular formula C34H26ClIN2O4 and a molecular weight of 688.95 g/mol. Its IUPAC name is (15S,19S)-17-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15S,19S)-17-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 126167506 |
| Molecular Formula | C34H26ClIN2O4 |
| Molecular Weight | 688.95 g/mol |
| Exact Mass | 688.06 |
| IUPAC Name | (15S,19S)-17-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | CCOc1cc(/C=N\N2C(=O)[C@H]3C4c5ccccc5C(c5ccccc54)[C@@H]3C2=O)cc(I)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C34H26ClIN2O4/c1-2-41-27-16-19(15-26(36)32(27)42-18-20-9-3-8-14-25(20)35)17-37-38-33(39)30-28-21-10-4-5-11-22(21)29(31(30)34(38)40)24-13-7-6-12-23(24)28/h3-17,28-31H,2,18H2,1H3/b37-17-/t28?,29?,30-,31-/m0/s1 |
| InChIKey | LCGHXOQDMKZEQW-USLYKOJMSA-N |
| XLogP | 7.15 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.95 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|