C27H23Cl2IN2O4 — CID 124908829
(1R,2R,6R,7R)-4-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione (PubChem CID 124908829) has the molecular formula C27H23Cl2IN2O4 and a molecular weight of 637.30 g/mol. Its IUPAC name is (1R,2R,6R,7R)-4-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione.
| Compound Name | (1R,2R,6R,7R)-4-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione |
|---|---|
| PubChem CID | 124908829 |
| Molecular Formula | C27H23Cl2IN2O4 |
| Molecular Weight | 637.30 g/mol |
| Exact Mass | 636.01 |
| IUPAC Name | (1R,2R,6R,7R)-4-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione |
| SMILES | CCOc1cc(/C=N\N2C(=O)[C@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C23CC3)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H23Cl2IN2O4/c1-2-35-21-10-14(9-20(30)24(21)36-13-15-3-4-16(28)11-19(15)29)12-31-32-25(33)22-17-5-6-18(23(22)26(32)34)27(17)7-8-27/h3-6,9-12,17-18,22-23H,2,7-8,13H2,1H3/b31-12-/t17-,18-,22-,23-/m1/s1 |
| InChIKey | UUBZYWRVJUOCTF-XLUPQUTRSA-N |
| XLogP | 6.11 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.30 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|