C22H21Cl2IN2O3S — CID 126083196
(5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-propyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126083196) has the molecular formula C22H21Cl2IN2O3S and a molecular weight of 591.30 g/mol. Its IUPAC name is (5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-propyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-propyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126083196 |
| Molecular Formula | C22H21Cl2IN2O3S |
| Molecular Weight | 591.30 g/mol |
| Exact Mass | 589.97 |
| IUPAC Name | (5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-propyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCCN1C(=O)/C(=C/c2cc(I)c(OCc3ccc(Cl)cc3Cl)c(OCC)c2)NC1=S |
| InChI | InChI=1S/C22H21Cl2IN2O3S/c1-3-7-27-21(28)18(26-22(27)31)9-13-8-17(25)20(19(10-13)29-4-2)30-12-14-5-6-15(23)11-16(14)24/h5-6,8-11H,3-4,7,12H2,1-2H3,(H,26,31)/b18-9- |
| InChIKey | CLXMCFIJUOOSSA-NVMNQCDNSA-N |
| XLogP | 6.04 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.30 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|