C21H20ClFN2O3S — CID 1003291
5-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 1003291) has the molecular formula C21H20ClFN2O3S and a molecular weight of 434.92 g/mol. Its IUPAC name is 5-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 1003291 |
| Molecular Formula | C21H20ClFN2O3S |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 5-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1cc(C=C2NC(=S)N(CC)C2=O)cc(Cl)c1OCc1ccccc1F |
| InChI | InChI=1S/C21H20ClFN2O3S/c1-3-25-20(26)17(24-21(25)29)10-13-9-15(22)19(18(11-13)27-4-2)28-12-14-7-5-6-8-16(14)23/h5-11H,3-4,12H2,1-2H3,(H,24,29) |
| InChIKey | KBPWMOVVYAOBIH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|