C19H15Cl3N2O2S — CID 1331639
5-[[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 1331639) has the molecular formula C19H15Cl3N2O2S and a molecular weight of 441.77 g/mol. Its IUPAC name is 5-[[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-[[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 1331639 |
| Molecular Formula | C19H15Cl3N2O2S |
| Molecular Weight | 441.77 g/mol |
| Exact Mass | 439.99 |
| IUPAC Name | 5-[[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCN1C(=O)C(=Cc2cc(Cl)c(OCc3ccccc3Cl)c(Cl)c2)NC1=S |
| InChI | InChI=1S/C19H15Cl3N2O2S/c1-2-24-18(25)16(23-19(24)27)9-11-7-14(21)17(15(22)8-11)26-10-12-5-3-4-6-13(12)20/h3-9H,2,10H2,1H3,(H,23,27) |
| InChIKey | CLFHJXGEOMFXKX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.77 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|