C34H25BrCl2N2O4 — CID 21370599
17-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 21370599) has the molecular formula C34H25BrCl2N2O4 and a molecular weight of 676.39 g/mol. Its IUPAC name is 17-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | 17-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 21370599 |
| Molecular Formula | C34H25BrCl2N2O4 |
| Molecular Weight | 676.39 g/mol |
| Exact Mass | 674.04 |
| IUPAC Name | 17-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | CCOc1cc(/C=N/N2C(=O)C3C4c5ccccc5C(c5ccccc54)C3C2=O)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C34H25BrCl2N2O4/c1-2-42-27-14-18(13-25(35)32(27)43-17-19-11-12-20(36)15-26(19)37)16-38-39-33(40)30-28-21-7-3-4-8-22(21)29(31(30)34(39)41)24-10-6-5-9-23(24)28/h3-16,28-31H,2,17H2,1H3/b38-16+ |
| InChIKey | YIMVVRSNLOFVJQ-AIMOZCANSA-N |
| XLogP | 7.96 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.39 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|