C32H20Cl2I2N2O3 — CID 126168660
(15S,19S)-17-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 126168660) has the molecular formula C32H20Cl2I2N2O3 and a molecular weight of 805.24 g/mol. Its IUPAC name is (15S,19S)-17-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15S,19S)-17-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 126168660 |
| Molecular Formula | C32H20Cl2I2N2O3 |
| Molecular Weight | 805.24 g/mol |
| Exact Mass | 803.89 |
| IUPAC Name | (15S,19S)-17-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1[C@H]2C3c4ccccc4C(c4ccccc43)[C@@H]2C(=O)N1/N=C\c1cc(I)c(OCc2ccc(Cl)cc2Cl)c(I)c1 |
| InChI | InChI=1S/C32H20Cl2I2N2O3/c33-18-10-9-17(23(34)13-18)15-41-30-24(35)11-16(12-25(30)36)14-37-38-31(39)28-26-19-5-1-2-6-20(19)27(29(28)32(38)40)22-8-4-3-7-21(22)26/h1-14,26-29H,15H2/b37-14-/t26?,27?,28-,29-/m0/s1 |
| InChIKey | VABGHCQEMOTKRG-HKEBLDPWSA-N |
| XLogP | 8.01 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.24 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|