C32H24ClIN2O5 — CID 5050972
5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione (PubChem CID 5050972) has the molecular formula C32H24ClIN2O5 and a molecular weight of 678.91 g/mol. Its IUPAC name is 5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 5050972 |
| Molecular Formula | C32H24ClIN2O5 |
| Molecular Weight | 678.91 g/mol |
| Exact Mass | 678.04 |
| IUPAC Name | 5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1cc(C=C2C(=O)N(c3ccccc3)C(=O)N(c3ccccc3)C2=O)cc(I)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C32H24ClIN2O5/c1-2-40-28-19-21(18-27(34)29(28)41-20-22-11-9-10-16-26(22)33)17-25-30(37)35(23-12-5-3-6-13-23)32(39)36(31(25)38)24-14-7-4-8-15-24/h3-19H,2,20H2,1H3 |
| InChIKey | WFJYJFYXIJHFRS-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.91 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|