C33H26IN3O6 — CID 126052581
2-[2-ethoxy-6-iodo-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-phenylacetamide (PubChem CID 126052581) has the molecular formula C33H26IN3O6 and a molecular weight of 687.49 g/mol. Its IUPAC name is 2-[2-ethoxy-6-iodo-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-ethoxy-6-iodo-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126052581 |
| Molecular Formula | C33H26IN3O6 |
| Molecular Weight | 687.49 g/mol |
| Exact Mass | 687.09 |
| IUPAC Name | 2-[2-ethoxy-6-iodo-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-phenylacetamide |
| SMILES | CCOc1cc(C=C2C(=O)N(c3ccccc3)C(=O)N(c3ccccc3)C2=O)cc(I)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C33H26IN3O6/c1-2-42-28-20-22(19-27(34)30(28)43-21-29(38)35-23-12-6-3-7-13-23)18-26-31(39)36(24-14-8-4-9-15-24)33(41)37(32(26)40)25-16-10-5-11-17-25/h3-20H,2,21H2,1H3,(H,35,38) |
| InChIKey | IXIHDUXSOIYSPF-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.49 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|