C30H28IN3O5S — CID 126390228
2-[2-ethoxy-4-[(E)-[1-(4-ethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-6-iodophenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126390228) has the molecular formula C30H28IN3O5S and a molecular weight of 669.54 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(E)-[1-(4-ethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-6-iodophenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[(E)-[1-(4-ethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-6-iodophenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126390228 |
| Molecular Formula | C30H28IN3O5S |
| Molecular Weight | 669.54 g/mol |
| Exact Mass | 669.08 |
| IUPAC Name | 2-[2-ethoxy-4-[(E)-[1-(4-ethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-6-iodophenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=S)N(c3ccc(CC)cc3)C2=O)cc(I)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C30H28IN3O5S/c1-4-19-8-12-22(13-9-19)34-29(37)23(28(36)33-30(34)40)14-20-15-24(31)27(25(16-20)38-5-2)39-17-26(35)32-21-10-6-18(3)7-11-21/h6-16H,4-5,17H2,1-3H3,(H,32,35)(H,33,36,40)/b23-14+ |
| InChIKey | JAFUBTFVLXVASS-OEAKJJBVSA-N |
| XLogP | 5.41 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|