C21H21BrN2O4 — CID 98093141
(1S,2R,6S,7R,8S,10S)-4-[(Z)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 98093141) has the molecular formula C21H21BrN2O4 and a molecular weight of 445.31 g/mol. Its IUPAC name is (1S,2R,6S,7R,8S,10S)-4-[(Z)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1S,2R,6S,7R,8S,10S)-4-[(Z)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 98093141 |
| Molecular Formula | C21H21BrN2O4 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | (1S,2R,6S,7R,8S,10S)-4-[(Z)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | CCOc1c(Br)cc(/C=N\N2C(=O)[C@@H]3[C@H]4C=C[C@H]([C@H]5C[C@H]45)[C@@H]3C2=O)cc1OC |
| InChI | InChI=1S/C21H21BrN2O4/c1-3-28-19-15(22)6-10(7-16(19)27-2)9-23-24-20(25)17-11-4-5-12(14-8-13(11)14)18(17)21(24)26/h4-7,9,11-14,17-18H,3,8H2,1-2H3/b23-9-/t11-,12+,13-,14-,17+,18-/m1/s1 |
| InChIKey | HURXVZKVZVQDDY-LHIYNLKYSA-N |
| XLogP | 3.24 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|