C37H28N2O4 — CID 124559013
(15R,19S)-17-[(Z)-[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 124559013) has the molecular formula C37H28N2O4 and a molecular weight of 564.64 g/mol. Its IUPAC name is (15R,19S)-17-[(Z)-[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19S)-17-[(Z)-[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 124559013 |
| Molecular Formula | C37H28N2O4 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | (15R,19S)-17-[(Z)-[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | COc1cc(/C=N\N2C(=O)[C@@H]3C4c5ccccc5C(c5ccccc54)[C@@H]3C2=O)ccc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C37H28N2O4/c1-42-31-19-22(17-18-30(31)43-21-24-11-8-10-23-9-2-3-12-25(23)24)20-38-39-36(40)34-32-26-13-4-5-14-27(26)33(35(34)37(39)41)29-16-7-6-15-28(29)32/h2-20,32-35H,21H2,1H3/b38-20-/t32?,33?,34-,35+ |
| InChIKey | IHNOGUGEPVGUPJ-GGHZCMHHSA-N |
| XLogP | 6.65 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|