C27H24BrNO2 — CID 126207553
1-[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]-N-(4-ethylphenyl)methanimine (PubChem CID 126207553) has the molecular formula C27H24BrNO2 and a molecular weight of 474.40 g/mol. Its IUPAC name is 1-[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]-N-(4-ethylphenyl)methanimine.
| Compound Name | 1-[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]-N-(4-ethylphenyl)methanimine |
|---|---|
| PubChem CID | 126207553 |
| Molecular Formula | C27H24BrNO2 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 1-[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]-N-(4-ethylphenyl)methanimine |
| SMILES | CCc1ccc(/N=C/c2cc(Br)c(OCc3cccc4ccccc34)c(OC)c2)cc1 |
| InChI | InChI=1S/C27H24BrNO2/c1-3-19-11-13-23(14-12-19)29-17-20-15-25(28)27(26(16-20)30-2)31-18-22-9-6-8-21-7-4-5-10-24(21)22/h4-17H,3,18H2,1-2H3/b29-17+ |
| InChIKey | LOOKRGDGOSPFCU-STBIYBPSSA-N |
| XLogP | 7.50 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|