C28H27BrN2O4 — CID 99945039
N-[(Z)-[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine (PubChem CID 99945039) has the molecular formula C28H27BrN2O4 and a molecular weight of 535.44 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine.
| Compound Name | N-[(Z)-[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 99945039 |
| Molecular Formula | C28H27BrN2O4 |
| Molecular Weight | 535.44 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | N-[(Z)-[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-(3,4-dimethoxyphenyl)methanamine |
| SMILES | COc1ccc(CN/N=C\c2cc(Br)c(OCc3cccc4ccccc34)c(OC)c2)cc1OC |
| InChI | InChI=1S/C28H27BrN2O4/c1-32-25-12-11-19(14-26(25)33-2)16-30-31-17-20-13-24(29)28(27(15-20)34-3)35-18-22-9-6-8-21-7-4-5-10-23(21)22/h4-15,17,30H,16,18H2,1-3H3/b31-17- |
| InChIKey | SMWGMJIMYPJBOZ-LJUMEUDFSA-N |
| XLogP | 6.33 |
| TPSA | 61.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.44 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|