C29H27BrN2O5 — CID 126308931
N-[(E)-[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide (PubChem CID 126308931) has the molecular formula C29H27BrN2O5 and a molecular weight of 563.45 g/mol. Its IUPAC name is N-[(E)-[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide.
| Compound Name | N-[(E)-[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 126308931 |
| Molecular Formula | C29H27BrN2O5 |
| Molecular Weight | 563.45 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | N-[(E)-[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2cc(Br)c(OCc3cccc4ccccc34)c(OC)c2)cc1OC |
| InChI | InChI=1S/C29H27BrN2O5/c1-4-36-25-13-12-21(16-26(25)34-2)29(33)32-31-17-19-14-24(30)28(27(15-19)35-3)37-18-22-10-7-9-20-8-5-6-11-23(20)22/h5-17H,4,18H2,1-3H3,(H,32,33)/b31-17+ |
| InChIKey | KHIRFSKRARUQNK-KBVAKVRCSA-N |
| XLogP | 6.36 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.45 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|