C28H25BrN2O4 — CID 126315248
N-[(E)-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-3-ethoxy-4-methoxybenzamide (PubChem CID 126315248) has the molecular formula C28H25BrN2O4 and a molecular weight of 533.42 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-3-ethoxy-4-methoxybenzamide.
| Compound Name | N-[(E)-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-3-ethoxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 126315248 |
| Molecular Formula | C28H25BrN2O4 |
| Molecular Weight | 533.42 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | N-[(E)-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-3-ethoxy-4-methoxybenzamide |
| SMILES | CCOc1cc(C(=O)N/N=C/c2ccc(OCc3cccc4ccccc34)c(Br)c2)ccc1OC |
| InChI | InChI=1S/C28H25BrN2O4/c1-3-34-27-16-21(12-14-26(27)33-2)28(32)31-30-17-19-11-13-25(24(29)15-19)35-18-22-9-6-8-20-7-4-5-10-23(20)22/h4-17H,3,18H2,1-2H3,(H,31,32)/b30-17+ |
| InChIKey | BIIFCSIJADFDCM-OCSSWDANSA-N |
| XLogP | 6.35 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.42 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|