C33H27ClN2O4 — CID 126320496
N-[(E)-[3-chloro-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide (PubChem CID 126320496) has the molecular formula C33H27ClN2O4 and a molecular weight of 551.04 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[(E)-[3-chloro-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 126320496 |
| Molecular Formula | C33H27ClN2O4 |
| Molecular Weight | 551.04 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | N-[(E)-[3-chloro-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide |
| SMILES | COc1cc(C(=O)N/N=C/c2ccc(OCc3cccc4ccccc34)c(Cl)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C33H27ClN2O4/c1-38-32-19-26(15-17-31(32)39-21-23-8-3-2-4-9-23)33(37)36-35-20-24-14-16-30(29(34)18-24)40-22-27-12-7-11-25-10-5-6-13-28(25)27/h2-20H,21-22H2,1H3,(H,36,37)/b35-20+ |
| InChIKey | FTFIBFWHMKNSJS-JEPNHJGPSA-N |
| XLogP | 7.42 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.04 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|