C25H24Cl2N2O4 — CID 126323378
N-[(E)-[3-chloro-4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-3-methoxy-4-propoxybenzamide (PubChem CID 126323378) has the molecular formula C25H24Cl2N2O4 and a molecular weight of 487.38 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-3-methoxy-4-propoxybenzamide.
| Compound Name | N-[(E)-[3-chloro-4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-3-methoxy-4-propoxybenzamide |
|---|---|
| PubChem CID | 126323378 |
| Molecular Formula | C25H24Cl2N2O4 |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | N-[(E)-[3-chloro-4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-3-methoxy-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)N/N=C/c2ccc(OCc3cccc(Cl)c3)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C25H24Cl2N2O4/c1-3-11-32-23-10-8-19(14-24(23)31-2)25(30)29-28-15-17-7-9-22(21(27)13-17)33-16-18-5-4-6-20(26)12-18/h4-10,12-15H,3,11,16H2,1-2H3,(H,29,30)/b28-15+ |
| InChIKey | STUIBVJBUQWAEH-RWPZCVJISA-N |
| XLogP | 6.13 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|