C20H21ClN2O6 — CID 126316909
2-[2-chloro-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 126316909) has the molecular formula C20H21ClN2O6 and a molecular weight of 420.85 g/mol. Its IUPAC name is 2-[2-chloro-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-chloro-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126316909 |
| Molecular Formula | C20H21ClN2O6 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 2-[2-chloro-4-[(E)-[(3-methoxy-4-propoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | CCCOc1ccc(C(=O)N/N=C/c2ccc(OCC(=O)O)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C20H21ClN2O6/c1-3-8-28-17-7-5-14(10-18(17)27-2)20(26)23-22-11-13-4-6-16(15(21)9-13)29-12-19(24)25/h4-7,9-11H,3,8,12H2,1-2H3,(H,23,26)(H,24,25)/b22-11+ |
| InChIKey | WKHFWXACBUNLDI-SSDVNMTOSA-N |
| XLogP | 3.36 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|