C27H23BrN2O4 — CID 126388440
N-[(Z)-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2,4-dimethoxybenzamide (PubChem CID 126388440) has the molecular formula C27H23BrN2O4 and a molecular weight of 519.40 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2,4-dimethoxybenzamide.
| Compound Name | N-[(Z)-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 126388440 |
| Molecular Formula | C27H23BrN2O4 |
| Molecular Weight | 519.40 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | N-[(Z)-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C\c2ccc(OCc3cccc4ccccc34)c(Br)c2)c(OC)c1 |
| InChI | InChI=1S/C27H23BrN2O4/c1-32-21-11-12-23(26(15-21)33-2)27(31)30-29-16-18-10-13-25(24(28)14-18)34-17-20-8-5-7-19-6-3-4-9-22(19)20/h3-16H,17H2,1-2H3,(H,30,31)/b29-16- |
| InChIKey | MQSUTUTZWDHTSF-MWLSYYOVSA-N |
| XLogP | 5.96 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.40 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|