C28H25IN2O5 — CID 126388643
N-[(Z)-[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2,4-dimethoxybenzamide (PubChem CID 126388643) has the molecular formula C28H25IN2O5 and a molecular weight of 596.42 g/mol. Its IUPAC name is N-[(Z)-[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2,4-dimethoxybenzamide.
| Compound Name | N-[(Z)-[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 126388643 |
| Molecular Formula | C28H25IN2O5 |
| Molecular Weight | 596.42 g/mol |
| Exact Mass | 596.08 |
| IUPAC Name | N-[(Z)-[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C\c2cc(I)c(OCc3cccc4ccccc34)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C28H25IN2O5/c1-33-21-11-12-23(25(15-21)34-2)28(32)31-30-16-18-13-24(29)27(26(14-18)35-3)36-17-20-9-6-8-19-7-4-5-10-22(19)20/h4-16H,17H2,1-3H3,(H,31,32)/b30-16- |
| InChIKey | ZKSHJRQZEKKEPL-UHBFCERESA-N |
| XLogP | 5.81 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.42 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|