C17H17BrN4O3 — CID 168592087
[2-bromo-4-[(diaminomethylidenehydrazinylidene)methyl]-6-ethoxyphenyl] benzoate (PubChem CID 168592087) has the molecular formula C17H17BrN4O3 and a molecular weight of 405.25 g/mol. Its IUPAC name is [2-bromo-4-[(diaminomethylidenehydrazinylidene)methyl]-6-ethoxyphenyl] benzoate.
| Compound Name | [2-bromo-4-[(diaminomethylidenehydrazinylidene)methyl]-6-ethoxyphenyl] benzoate |
|---|---|
| PubChem CID | 168592087 |
| Molecular Formula | C17H17BrN4O3 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | [2-bromo-4-[(diaminomethylidenehydrazinylidene)methyl]-6-ethoxyphenyl] benzoate |
| SMILES | CCOc1cc(C=NN=C(N)N)cc(Br)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H17BrN4O3/c1-2-24-14-9-11(10-21-22-17(19)20)8-13(18)15(14)25-16(23)12-6-4-3-5-7-12/h3-10H,2H2,1H3,(H4,19,20,22) |
| InChIKey | AMUXRXZWUWCHHN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|