About (2-bromo-6-ethoxy-4-formylphenyl) 3-bromobenzoate
(2-bromo-6-ethoxy-4-formylphenyl) 3-bromobenzoate (PubChem CID 4766839) has the molecular formula C16H12Br2O4
and a molecular weight of 428.08 g/mol. Its IUPAC name is (2-bromo-6-ethoxy-4-formylphenyl) 3-bromobenzoate.
Molecular Properties
| Compound Name | (2-bromo-6-ethoxy-4-formylphenyl) 3-bromobenzoate |
| PubChem CID | 4766839 |
| Molecular Formula | C16H12Br2O4 |
| Molecular Weight | 428.08 g/mol |
| Exact Mass | 425.91 |
| IUPAC Name | (2-bromo-6-ethoxy-4-formylphenyl) 3-bromobenzoate |
| SMILES | CCOc1cc(C=O)cc(Br)c1OC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H12Br2O4/c1-2-21-14-7-10(9-19)6-13(18)15(14)22-16(20)11-4-3-5-12(17)8-11/h3-9H,2H2,1H3 |
| InChIKey | VVHUMGYTDGJIDW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.08 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-6-ethoxy-4-formylphenyl) 3-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-6-ethoxy-4-formylphenyl) 3-bromobenzoate?
The IUPAC name of (2-bromo-6-ethoxy-4-formylphenyl) 3-bromobenzoate (CID 4766839) is (2-bromo-6-ethoxy-4-formylphenyl) 3-bromobenzoate.
What is the SMILES notation for (2-bromo-6-ethoxy-4-formylphenyl) 3-bromobenzoate?
The canonical SMILES for (2-bromo-6-ethoxy-4-formylphenyl) 3-bromobenzoate is CCOc1cc(C=O)cc(Br)c1OC(=O)c1cccc(Br)c1.
What is the InChIKey of (2-bromo-6-ethoxy-4-formylphenyl) 3-bromobenzoate?
The InChIKey is VVHUMGYTDGJIDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Br2O4/c1-2-21-14-7-10(9-19)6-13(18)15(14)22-16(20)11-4-3-5-12(17)8-11/h3-9H,2H2,1H3.
What are the key properties of (2-bromo-6-ethoxy-4-formylphenyl) 3-bromobenzoate?
(2-bromo-6-ethoxy-4-formylphenyl) 3-bromobenzoate has a molecular weight of 428.08 g/mol, XLogP of 4.64, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-6-ethoxy-4-formylphenyl) 3-bromobenzoate is sourced from PubChem (CID 4766839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).