C18H17Br2NO4 — CID 23935761
2-(2-bromo-6-ethoxy-4-formylphenoxy)-N-(4-bromo-2-methylphenyl)acetamide (PubChem CID 23935761) has the molecular formula C18H17Br2NO4 and a molecular weight of 471.15 g/mol. Its IUPAC name is 2-(2-bromo-6-ethoxy-4-formylphenoxy)-N-(4-bromo-2-methylphenyl)acetamide.
| Compound Name | 2-(2-bromo-6-ethoxy-4-formylphenoxy)-N-(4-bromo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 23935761 |
| Molecular Formula | C18H17Br2NO4 |
| Molecular Weight | 471.15 g/mol |
| Exact Mass | 468.95 |
| IUPAC Name | 2-(2-bromo-6-ethoxy-4-formylphenoxy)-N-(4-bromo-2-methylphenyl)acetamide |
| SMILES | CCOc1cc(C=O)cc(Br)c1OCC(=O)Nc1ccc(Br)cc1C |
| InChI | InChI=1S/C18H17Br2NO4/c1-3-24-16-8-12(9-22)7-14(20)18(16)25-10-17(23)21-15-5-4-13(19)6-11(15)2/h4-9H,3,10H2,1-2H3,(H,21,23) |
| InChIKey | WTWOCKFTVNGASO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.15 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|