C17H15BrClNO4 — CID 1284879
2-(2-bromo-6-ethoxy-4-formylphenoxy)-N-(2-chlorophenyl)acetamide (PubChem CID 1284879) has the molecular formula C17H15BrClNO4 and a molecular weight of 412.67 g/mol. Its IUPAC name is 2-(2-bromo-6-ethoxy-4-formylphenoxy)-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-(2-bromo-6-ethoxy-4-formylphenoxy)-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 1284879 |
| Molecular Formula | C17H15BrClNO4 |
| Molecular Weight | 412.67 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 2-(2-bromo-6-ethoxy-4-formylphenoxy)-N-(2-chlorophenyl)acetamide |
| SMILES | CCOc1cc(C=O)cc(Br)c1OCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H15BrClNO4/c1-2-23-15-8-11(9-21)7-12(18)17(15)24-10-16(22)20-14-6-4-3-5-13(14)19/h3-9H,2,10H2,1H3,(H,20,22) |
| InChIKey | QOUYXFISIYEPPJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.67 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|