C16H15BrN2O3 — CID 129452144
[4-(hydrazinecarbonyl)-2,6-dimethylphenyl] 3-bromobenzoate (PubChem CID 129452144) has the molecular formula C16H15BrN2O3 and a molecular weight of 363.21 g/mol. Its IUPAC name is [4-(hydrazinecarbonyl)-2,6-dimethylphenyl] 3-bromobenzoate.
| Compound Name | [4-(hydrazinecarbonyl)-2,6-dimethylphenyl] 3-bromobenzoate |
|---|---|
| PubChem CID | 129452144 |
| Molecular Formula | C16H15BrN2O3 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | [4-(hydrazinecarbonyl)-2,6-dimethylphenyl] 3-bromobenzoate |
| SMILES | Cc1cc(C(=O)NN)cc(C)c1OC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H15BrN2O3/c1-9-6-12(15(20)19-18)7-10(2)14(9)22-16(21)11-4-3-5-13(17)8-11/h3-8H,18H2,1-2H3,(H,19,20) |
| InChIKey | UIZABXJBFWTORJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|