C11H12BrNO5 — CID 5412063
2-[2-bromo-6-ethoxy-4-[(Z)-hydroxyiminomethyl]phenoxy]acetic acid (PubChem CID 5412063) has the molecular formula C11H12BrNO5 and a molecular weight of 318.12 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-[(Z)-hydroxyiminomethyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-6-ethoxy-4-[(Z)-hydroxyiminomethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 5412063 |
| Molecular Formula | C11H12BrNO5 |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-[(Z)-hydroxyiminomethyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(/C=N\O)cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C11H12BrNO5/c1-2-17-9-4-7(5-13-16)3-8(12)11(9)18-6-10(14)15/h3-5,16H,2,6H2,1H3,(H,14,15)/b13-5- |
| InChIKey | SQHQOZTTXOHLNA-ACAGNQJTSA-N |
| XLogP | 2.12 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|