C18H16BrF3N2O4 — CID 4575031
2-[2-bromo-6-ethoxy-4-[[[3-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 4575031) has the molecular formula C18H16BrF3N2O4 and a molecular weight of 461.23 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-[[[3-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-6-ethoxy-4-[[[3-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 4575031 |
| Molecular Formula | C18H16BrF3N2O4 |
| Molecular Weight | 461.23 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-[[[3-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(C=NNc2cccc(C(F)(F)F)c2)cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C18H16BrF3N2O4/c1-2-27-15-7-11(6-14(19)17(15)28-10-16(25)26)9-23-24-13-5-3-4-12(8-13)18(20,21)22/h3-9,24H,2,10H2,1H3,(H,25,26) |
| InChIKey | KLXJZTSRSXDCMU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.23 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|