C15H11Br2F3N2O — CID 110841663
N-[(3,5-dibromo-4-methoxyphenyl)methylideneamino]-3-(trifluoromethyl)aniline (PubChem CID 110841663) has the molecular formula C15H11Br2F3N2O and a molecular weight of 452.07 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-methoxyphenyl)methylideneamino]-3-(trifluoromethyl)aniline.
| Compound Name | N-[(3,5-dibromo-4-methoxyphenyl)methylideneamino]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 110841663 |
| Molecular Formula | C15H11Br2F3N2O |
| Molecular Weight | 452.07 g/mol |
| Exact Mass | 449.92 |
| IUPAC Name | N-[(3,5-dibromo-4-methoxyphenyl)methylideneamino]-3-(trifluoromethyl)aniline |
| SMILES | COc1c(Br)cc(C=NNc2cccc(C(F)(F)F)c2)cc1Br |
| InChI | InChI=1S/C15H11Br2F3N2O/c1-23-14-12(16)5-9(6-13(14)17)8-21-22-11-4-2-3-10(7-11)15(18,19)20/h2-8,22H,1H3 |
| InChIKey | SDZSZXHTPSMNTK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.07 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|