C16H14ClF3N2O2 — CID 110841727
N-[(2-chloro-3,4-dimethoxyphenyl)methylideneamino]-3-(trifluoromethyl)aniline (PubChem CID 110841727) has the molecular formula C16H14ClF3N2O2 and a molecular weight of 358.75 g/mol. Its IUPAC name is N-[(2-chloro-3,4-dimethoxyphenyl)methylideneamino]-3-(trifluoromethyl)aniline.
| Compound Name | N-[(2-chloro-3,4-dimethoxyphenyl)methylideneamino]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 110841727 |
| Molecular Formula | C16H14ClF3N2O2 |
| Molecular Weight | 358.75 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | N-[(2-chloro-3,4-dimethoxyphenyl)methylideneamino]-3-(trifluoromethyl)aniline |
| SMILES | COc1ccc(C=NNc2cccc(C(F)(F)F)c2)c(Cl)c1OC |
| InChI | InChI=1S/C16H14ClF3N2O2/c1-23-13-7-6-10(14(17)15(13)24-2)9-21-22-12-5-3-4-11(8-12)16(18,19)20/h3-9,22H,1-2H3 |
| InChIKey | ATJFFSWOCOQNOU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.75 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|