C16H15ClF3N3O3 — CID 6143287
3-chloro-5-(trifluoromethyl)-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]pyridin-2-amine (PubChem CID 6143287) has the molecular formula C16H15ClF3N3O3 and a molecular weight of 389.76 g/mol. Its IUPAC name is 3-chloro-5-(trifluoromethyl)-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]pyridin-2-amine.
| Compound Name | 3-chloro-5-(trifluoromethyl)-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 6143287 |
| Molecular Formula | C16H15ClF3N3O3 |
| Molecular Weight | 389.76 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 3-chloro-5-(trifluoromethyl)-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]pyridin-2-amine |
| SMILES | COc1ccc(/C=N\Nc2ncc(C(F)(F)F)cc2Cl)c(OC)c1OC |
| InChI | InChI=1S/C16H15ClF3N3O3/c1-24-12-5-4-9(13(25-2)14(12)26-3)7-22-23-15-11(17)6-10(8-21-15)16(18,19)20/h4-8H,1-3H3,(H,21,23)/b22-7- |
| InChIKey | NFDFOGXGKSCYTI-HOEBFWFUSA-N |
| XLogP | 4.23 |
| TPSA | 64.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.76 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|