C15H9ClF3N3O2 — CID 135778423
3-[(E)-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-2-benzofuran-1-ol (PubChem CID 135778423) has the molecular formula C15H9ClF3N3O2 and a molecular weight of 355.70 g/mol. Its IUPAC name is 3-[(E)-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-2-benzofuran-1-ol.
| Compound Name | 3-[(E)-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-2-benzofuran-1-ol |
|---|---|
| PubChem CID | 135778423 |
| Molecular Formula | C15H9ClF3N3O2 |
| Molecular Weight | 355.70 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 3-[(E)-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-2-benzofuran-1-ol |
| SMILES | Oc1oc(/C=N/Nc2ncc(C(F)(F)F)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C15H9ClF3N3O2/c16-11-5-8(15(17,18)19)6-20-13(11)22-21-7-12-9-3-1-2-4-10(9)14(23)24-12/h1-7,23H,(H,20,22)/b21-7+ |
| InChIKey | GGDJLJQGFNUYBY-QPSGOUHRSA-N |
| XLogP | 4.65 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.70 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|