C16H14ClF3N4O3 — CID 9216919
2-[4-[(Z)-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetamide (PubChem CID 9216919) has the molecular formula C16H14ClF3N4O3 and a molecular weight of 402.76 g/mol. Its IUPAC name is 2-[4-[(Z)-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(Z)-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 9216919 |
| Molecular Formula | C16H14ClF3N4O3 |
| Molecular Weight | 402.76 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 2-[4-[(Z)-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(/C=N\Nc2ncc(C(F)(F)F)cc2Cl)ccc1OCC(N)=O |
| InChI | InChI=1S/C16H14ClF3N4O3/c1-26-13-4-9(2-3-12(13)27-8-14(21)25)6-23-24-15-11(17)5-10(7-22-15)16(18,19)20/h2-7H,8H2,1H3,(H2,21,25)(H,22,24)/b23-6- |
| InChIKey | JCHKTQGFJFGIJD-OUBWWKSTSA-N |
| XLogP | 3.07 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.76 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|