C14H13Cl2N3O2 — CID 6217597
3,5-dichloro-N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]pyridin-2-amine (PubChem CID 6217597) has the molecular formula C14H13Cl2N3O2 and a molecular weight of 326.18 g/mol. Its IUPAC name is 3,5-dichloro-N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 6217597 |
| Molecular Formula | C14H13Cl2N3O2 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 3,5-dichloro-N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]pyridin-2-amine |
| SMILES | COc1ccc(/C=N\Nc2ncc(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C14H13Cl2N3O2/c1-20-12-4-3-9(5-13(12)21-2)7-18-19-14-11(16)6-10(15)8-17-14/h3-8H,1-2H3,(H,17,19)/b18-7- |
| InChIKey | NENWCTDCIIOUHB-WSVATBPTSA-N |
| XLogP | 3.85 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|