C14H11ClF3N3O2 — CID 135608192
4-[(E)-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-2-methoxyphenol (PubChem CID 135608192) has the molecular formula C14H11ClF3N3O2 and a molecular weight of 345.71 g/mol. Its IUPAC name is 4-[(E)-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-2-methoxyphenol.
| Compound Name | 4-[(E)-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 135608192 |
| Molecular Formula | C14H11ClF3N3O2 |
| Molecular Weight | 345.71 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 4-[(E)-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-2-methoxyphenol |
| SMILES | COc1cc(/C=N/Nc2ncc(C(F)(F)F)cc2Cl)ccc1O |
| InChI | InChI=1S/C14H11ClF3N3O2/c1-23-12-4-8(2-3-11(12)22)6-20-21-13-10(15)5-9(7-19-13)14(16,17)18/h2-7,22H,1H3,(H,19,21)/b20-6+ |
| InChIKey | GTKXROMUMXMUHB-CGOBSMCZSA-N |
| XLogP | 3.91 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.71 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|