C16H16ClF3N4O — CID 4840391
2-[4-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-N-methylanilino]ethanol (PubChem CID 4840391) has the molecular formula C16H16ClF3N4O and a molecular weight of 372.78 g/mol. Its IUPAC name is 2-[4-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-N-methylanilino]ethanol.
| Compound Name | 2-[4-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-N-methylanilino]ethanol |
|---|---|
| PubChem CID | 4840391 |
| Molecular Formula | C16H16ClF3N4O |
| Molecular Weight | 372.78 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 2-[4-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-N-methylanilino]ethanol |
| SMILES | CN(CCO)c1ccc(C=NNc2ncc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C16H16ClF3N4O/c1-24(6-7-25)13-4-2-11(3-5-13)9-22-23-15-14(17)8-12(10-21-15)16(18,19)20/h2-5,8-10,25H,6-7H2,1H3,(H,21,23) |
| InChIKey | KYXRTUJNMWGFBD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 60.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.78 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|