C22H17ClF3N3O4 — CID 4999008
[4-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methoxybenzoate (PubChem CID 4999008) has the molecular formula C22H17ClF3N3O4 and a molecular weight of 479.84 g/mol. Its IUPAC name is [4-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methoxybenzoate.
| Compound Name | [4-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 4999008 |
| Molecular Formula | C22H17ClF3N3O4 |
| Molecular Weight | 479.84 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | [4-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(C=NNc3ncc(C(F)(F)F)cc3Cl)cc2OC)cc1 |
| InChI | InChI=1S/C22H17ClF3N3O4/c1-31-16-6-4-14(5-7-16)21(30)33-18-8-3-13(9-19(18)32-2)11-28-29-20-17(23)10-15(12-27-20)22(24,25)26/h3-12H,1-2H3,(H,27,29) |
| InChIKey | SIPDTDIXGALTIB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.84 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|