C23H17FN4O3 — CID 6788421
[2-methoxy-4-[(phthalazin-1-ylhydrazinylidene)methyl]phenyl] 4-fluorobenzoate (PubChem CID 6788421) has the molecular formula C23H17FN4O3 and a molecular weight of 416.41 g/mol. Its IUPAC name is [2-methoxy-4-[(phthalazin-1-ylhydrazinylidene)methyl]phenyl] 4-fluorobenzoate.
| Compound Name | [2-methoxy-4-[(phthalazin-1-ylhydrazinylidene)methyl]phenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 6788421 |
| Molecular Formula | C23H17FN4O3 |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | [2-methoxy-4-[(phthalazin-1-ylhydrazinylidene)methyl]phenyl] 4-fluorobenzoate |
| SMILES | COc1cc(C=NNc2nncc3ccccc23)ccc1OC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H17FN4O3/c1-30-21-12-15(6-11-20(21)31-23(29)16-7-9-18(24)10-8-16)13-25-27-22-19-5-3-2-4-17(19)14-26-28-22/h2-14H,1H3,(H,27,28) |
| InChIKey | LEOGHRLFSDLBRI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|