C16H14N4O — CID 6831939
N-[(3-methoxyphenyl)methylideneamino]phthalazin-1-amine (PubChem CID 6831939) has the molecular formula C16H14N4O and a molecular weight of 278.32 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methylideneamino]phthalazin-1-amine.
| Compound Name | N-[(3-methoxyphenyl)methylideneamino]phthalazin-1-amine |
|---|---|
| PubChem CID | 6831939 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-[(3-methoxyphenyl)methylideneamino]phthalazin-1-amine |
| SMILES | COc1cccc(C=NNc2nncc3ccccc23)c1 |
| InChI | InChI=1S/C16H14N4O/c1-21-14-7-4-5-12(9-14)10-17-19-16-15-8-3-2-6-13(15)11-18-20-16/h2-11H,1H3,(H,19,20) |
| InChIKey | PIQUNDFWPNZZGJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|