C24H26N10O — CID 87873725
(E)-(4-methoxyphenyl)methylidenehydrazine;bis(phthalazin-1-ylhydrazine) (PubChem CID 87873725) has the molecular formula C24H26N10O and a molecular weight of 470.54 g/mol. Its IUPAC name is (E)-(4-methoxyphenyl)methylidenehydrazine;bis(phthalazin-1-ylhydrazine).
| Compound Name | (E)-(4-methoxyphenyl)methylidenehydrazine;bis(phthalazin-1-ylhydrazine) |
|---|---|
| PubChem CID | 87873725 |
| Molecular Formula | C24H26N10O |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | (E)-(4-methoxyphenyl)methylidenehydrazine;bis(phthalazin-1-ylhydrazine) |
| SMILES | COc1ccc(/C=N/N)cc1.NNc1nncc2ccccc12.NNc1nncc2ccccc12 |
| InChI | InChI=1S/2C8H8N4.C8H10N2O/c2*9-11-8-7-4-2-1-3-6(7)5-10-12-8;1-11-8-4-2-7(3-5-8)6-10-9/h2*1-5H,9H2,(H,11,12);2-6H,9H2,1H3/b;;10-6+ |
| InChIKey | PQROZPUEWRBETR-RAJGKXNXSA-N |
| XLogP | 2.82 |
| TPSA | 175.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|