C30H24FN7O3 — CID 137059596
[4-[(Z)-[[4,6-bis(phenylimino)-1H-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-fluorobenzoate (PubChem CID 137059596) has the molecular formula C30H24FN7O3 and a molecular weight of 549.57 g/mol. Its IUPAC name is [4-[(Z)-[[4,6-bis(phenylimino)-1H-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-fluorobenzoate.
| Compound Name | [4-[(Z)-[[4,6-bis(phenylimino)-1H-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 137059596 |
| Molecular Formula | C30H24FN7O3 |
| Molecular Weight | 549.57 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | [4-[(Z)-[[4,6-bis(phenylimino)-1H-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-fluorobenzoate |
| SMILES | COc1cc(/C=N\Nc2n/c(=N\c3ccccc3)[nH]/c(=N/c3ccccc3)[nH]2)ccc1OC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H24FN7O3/c1-40-26-18-20(12-17-25(26)41-27(39)21-13-15-22(31)16-14-21)19-32-38-30-36-28(33-23-8-4-2-5-9-23)35-29(37-30)34-24-10-6-3-7-11-24/h2-19H,1H3,(H3,33,34,35,36,37,38)/b32-19- |
| InChIKey | FRHKRZOIWZDODB-MZFJOGFUSA-N |
| XLogP | 5.02 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|