C23H20FN3O3S — CID 4240915
[4-[(benzylcarbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] 4-fluorobenzoate (PubChem CID 4240915) has the molecular formula C23H20FN3O3S and a molecular weight of 437.50 g/mol. Its IUPAC name is [4-[(benzylcarbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] 4-fluorobenzoate.
| Compound Name | [4-[(benzylcarbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 4240915 |
| Molecular Formula | C23H20FN3O3S |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | [4-[(benzylcarbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] 4-fluorobenzoate |
| SMILES | COc1cc(C=NNC(=S)NCc2ccccc2)ccc1OC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H20FN3O3S/c1-29-21-13-17(15-26-27-23(31)25-14-16-5-3-2-4-6-16)7-12-20(21)30-22(28)18-8-10-19(24)11-9-18/h2-13,15H,14H2,1H3,(H2,25,27,31) |
| InChIKey | JSQJXLHHWXMVPO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|