C23H22FN3O2S — CID 110338066
1-benzyl-3-[(E)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]thiourea (PubChem CID 110338066) has the molecular formula C23H22FN3O2S and a molecular weight of 423.51 g/mol. Its IUPAC name is 1-benzyl-3-[(E)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]thiourea.
| Compound Name | 1-benzyl-3-[(E)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 110338066 |
| Molecular Formula | C23H22FN3O2S |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 1-benzyl-3-[(E)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]thiourea |
| SMILES | COc1cc(/C=N/NC(=S)NCc2ccccc2)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C23H22FN3O2S/c1-28-22-13-18(11-12-21(22)29-16-19-9-5-6-10-20(19)24)15-26-27-23(30)25-14-17-7-3-2-4-8-17/h2-13,15H,14,16H2,1H3,(H2,25,27,30)/b26-15+ |
| InChIKey | GCGAZUWYZKVYMJ-CVKSISIWSA-N |
| XLogP | 4.41 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|