C19H22N4O4S — CID 8826313
2-[4-[(Z)-(benzylcarbamothioylhydrazinylidene)methyl]-2,6-dimethoxyphenoxy]acetamide (PubChem CID 8826313) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is 2-[4-[(Z)-(benzylcarbamothioylhydrazinylidene)methyl]-2,6-dimethoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(Z)-(benzylcarbamothioylhydrazinylidene)methyl]-2,6-dimethoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 8826313 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-[4-[(Z)-(benzylcarbamothioylhydrazinylidene)methyl]-2,6-dimethoxyphenoxy]acetamide |
| SMILES | COc1cc(/C=N\NC(=S)NCc2ccccc2)cc(OC)c1OCC(N)=O |
| InChI | InChI=1S/C19H22N4O4S/c1-25-15-8-14(9-16(26-2)18(15)27-12-17(20)24)11-22-23-19(28)21-10-13-6-4-3-5-7-13/h3-9,11H,10,12H2,1-2H3,(H2,20,24)(H2,21,23,28)/b22-11- |
| InChIKey | OSZDSQJSLMBOJM-JJFYIABZSA-N |
| XLogP | 1.57 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|